NHS-Ac-N3
NHS-Ac-N3 is a paramount reagent within biomedicine and emerges as an exquisite modulator for drug advancement and biomolecule conjugation. This compound has unique chemical properties that play a key role in the fusion of multiple drugs and bioconjugates, aiding in the development of effective treatments for diseases such as cancer, neurodegenerative diseases, and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-007989 |
| Pricing | Inquire |
| Cas | 824426-32-6 |
| Molecular Weight | 198.13 |
| Molecular Formula | C6H6N4O4 |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CN=[N+]=[N-] |