Osilodrostat-[13C,d4,15N]
Osilodrostat-[13C,d4,15N], is an isotope labelled derivative of Osilodrostat. Osilodrostat, also called as LCI699, is a modulator of 11-β-hydroxylase (IC50= 2.5 nM), useful for treating a disorder ameliorated 11-β-hydroxylase inhibition, and a potent inhibitor of aldosterone synthase (IC50= 0.7 nM).
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003689 |
| Pricing | Inquire |
| Molecular Weight | 233.25 |
| Molecular Formula | C12[13C]H6D4FN2[15N] |
| Canonical SMILES | C1CC2=CN=CN2C1C3=C(C=C(C=C3)C#N)F |