4-Chloro-2-nitrobenzenediazonium Chloride
4-Chloro-2-nitrobenzenediazonium Chloride is reduced in the presence of hypophosphorous acid and carbon powder resulting in functionalized carbon powder with chloronitrophenyl groups attached on carbon particle surface;Also, it is an intermediate used in the synthesis of 2,4-Di-tert-butyl-6-(5-chloro-2H-benzotriazol-2-yl)phenol-d20 (D428017), which is an isotope labelled form of 2,4-Di-tert-butyl-6-(5-chloro-2H-benzotriazol-2-yl)phenol (D428015), which is a UV absorber.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB069955 |
| Pricing | Inquire |
| Cas | 119-09-5 |
| Molecular Weight | 220.01 |
| Molecular Formula | C6H3Cl2N3O2 |
| Canonical SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])[N+]#N.[Cl-] |