Leukotriene C4 methyl ester
Leukotriene C4 is a cysteinyl leukotriene produced by the LTC4 synthase catalyzed conjugation of glutathione to LTA4. LTC4 acts as an agonist of smooth muscle contraction. LTC4-induced bronchoconstriction and enhanced vascular permeability contribute to the pathogenesis of asthma and acute allergic hypersensitivity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73958-10-8 |
| Pricing | Inquire |
| Cas | 73958-10-8 |
| Molecular Weight | 639.8 |
| Molecular Formula | C31H49N3O9S |
| Canonical SMILES | CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)OC)O)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N |