MMAE
Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05782 |
| Pricing | Inquire |
| Cas | 474645-27-7 |
| Molecular Weight | 717.98 |
| Molecular Formula | C39H67N5O7 |
| Canonical SMILES | CC(C)C(C(CC(=O)N1CCCC1C(C(C)C(=O)NC(C)C(C2=CC=CC=C2)O)OC)OC)N(C)C(=O)C(C(C)C)NC(=O)C(C(C)C)NC |