Methyl 2,3,4-tri-O-acetyl-b-D-thiogalacturonide methyl ester
Methyl 2,3,4-tri-O-acetyl-b-D-thiogalacturonide methyl ester, a chemical compound utilized in the biopharmaceutical industry for synthesizing crucial carbohydrates involved in the management and treatment of varied diseases, including but not limited to cancer, diabetes, and infectious diseases, also plays a pivotal role in better understanding the intricate structure and function of these essential molecules within biological systems.
Supplier | BOC Sciences |
---|---|
Product # | 129541-34-0 |
Pricing | Inquire |
Cas | 129541-34-0 |
Molecular Weight | 364.37 |
Molecular Formula | C14H20O9S |
Canonical SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)SC)C(=O)OC)OC(=O)C |