Scopoletin b-D-glucuronide
Scopoletin b-D-glucuronide, an esteemed biomedical compound, emerges as a panacea for diverse afflictions. Emanating robust anti-inflammatory and antioxidant attributes, it unravels its profound worth in combatting arthritis and counteracting oxidative stress-related maladies. Unraveling its mechanisms, this exceptional product impedes targeted enzymes and signaling cascades, thereby assuaging torment, mitigating inflammation, and ameliorating cellular lesions entwined with these pathological conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 132752-65-9 |
| Pricing | Inquire |
| Cas | 132752-65-9 |
| Molecular Weight | 368.29 |
| Molecular Formula | C16H16O10 |
| Canonical SMILES | COC1=C(C=C2C(=C1)C=CC(=O)O2)OC3C(C(C(C(O3)C(=O)O)O)O)O |