N6-(6-Aminohexyl)-2'-deoxyadenosine
N6-(6-Aminohexyl)-2'-deoxyadenosine encompasses an intricate molecular framework, rendering it an acclaimed adipose for groundbreaking scientific investigations. Serving as a discerning adenine nucleoside derivative, it has become the cornerstone for DNA modification explorations and the pioneering development of medicament transmission schemes. With its unparalleled structure, this exceptional compound assumes a pivotal role in shaping bespoke curative approaches targeting an array of pathologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 147218-60-8 |
| Pricing | Inquire |
| Cas | 147218-60-8 |
| Molecular Weight | 350.43 |
| Molecular Formula | C16H26N6O3 |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)NCCCCCCN)CO)O |