methyl 2,3-di-O-acetyl-6-O-trityl-α-D-glucopyranoside
Methyl 2,3-di-O-acetyl-6-O-trityl-α-D-glucopyranoside - an organic compound frequently employed in biomedical research for its selectivity towards particular proteins, thus presenting as a valuable asset in the field of drug development. Further, its application extends to neurological disorder investigations and cancer-related inquiries. Its vast scope of action underlines its significance within the scientific community.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53717-00-3 |
| Pricing | Inquire |
| Cas | 53717-00-3 |
| Molecular Weight | 520.57 |
| Molecular Formula | C30H32O8 |
| Canonical SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)OC)COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)O |