Trimethyloctylammonium chloride
Trimethyloctylammonium chloride is a paramount compound omnipresent in the biomedical domain and assumes a pivotal role in pharmaceutical synthesis. With widespread utilization in an array of drug concoctions and remedies targeting maladies, this prodigious entity actively contributes to the formulation of curative interventions for bacterial infections, neurological anomalies, and cardiovascular afflictions alike.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10108-86-8 |
| Pricing | Inquire |
| Cas | 10108-86-8 |
| Molecular Weight | 207.78 |
| Molecular Formula | C11H26ClN |
| Canonical SMILES | CCCCCCCC[N+](C)(C)C.[Cl-] |