Vicenistatin M
It is produced by the strain of Streptomyces sp. HC-34. It is a homologue of Mycarose replacing amino sugars in the Vicenstatin molecule, and it loses the cytotoxicity of Vicenstatin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02960 |
| Pricing | Inquire |
| Cas | 312532-50-6 |
| Molecular Weight | 501.70 |
| Molecular Formula | C30H47NO5 |
| Canonical SMILES | CC1CCC=CC=C(CC(=CCC(C(C=CC=CC(=O)NC1)C)OC2CC(C(C(O2)C)O)(C)O)C)C |