(Z,Z)-5,11-Eicosadienoic Acid
(Z,Z)-5,11-Eicosadienoic acid is a polyunsaturated omega-6 fatty acid with 20 carbon atoms and two double bonds in the fifth and eleventh positions. It is commonly found in various plant oils and has been associated with various health benefits, including anti-inflammatory properties and potential protection against heart disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70363-48-3 |
| Pricing | Inquire |
| Cas | 70363-48-3 |
| Molecular Weight | 308.50 |
| Molecular Formula | C20H36O2 |
| Canonical SMILES | CCCCCCCCC=CCCCCC=CCCCC(=O)O |