1,3,5-Tri-O-benzoyl-α-D-arabinofuranose
1,3,5-Tri-O-benzoyl-α-D-arabinofuranose, a compound widely used in biomedical industry, exhibits tremendous potential in catalyzing the synthesis of diverse pharmaceuticals, especially nucleoside analogs that exhibit potent activity against viral infections, such as HIV and Hepatitis. Moreover, this versatile compound also serves as a precursor in the synthesis of arabinonucleic acids that possess remarkable attributes in investigating and treating genetic disorders, thereby holding immense promise in a range of therapeutic applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 314289-48-0 |
| Pricing | Inquire |
| Cas | 314289-48-0 |
| Molecular Weight | 462.45 |
| Molecular Formula | C26H22O8 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)OC(=O)C3=CC=CC=C3)O)OC(=O)C4=CC=CC=C4 |