5-Aminoallyl-2'-deoxyuridine 5'-triphosphate, labeled with 5/6-TAMRA
5-Aminoallyl-2'-deoxyuridine 5'-triphosphate, labeled with 5/6-TAMRA is a vital tool in the biomedical industry for DNA modification. This product finds application in fluorescent labeling of nucleotides during PCR or DNA sequencing processes. It allows for accurate detection and visualization of DNA sequences, aiding in disease diagnosis, drug discovery, and genetic research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 151345-35-6 |
| Pricing | Inquire |
| Cas | 151345-35-6 |
| Molecular Weight | 935.66 (free acid) |
| Molecular Formula | C37H40N5O18P3 |
| Canonical SMILES | CN(C)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(C)C)C5=C(C=CC(=C5)C(=O)NCC=CC6=CN(C(=O)NC6=O)C7CC(C(O7)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)C(=O)O3 |