O-(tert-Butyl)-N,N'-diisopropylisourea
O-(tert-Butyl)-N,N'-diisopropylisourea (CAS# 71432-55-8) is a useful synthetic intermediate in the synthesis of 5-Oxo Atorvastatin tert-Butyl Ester (O847160) which is a Boc-protected derivative of Atorvastatin (A791750, Ca Salt). 2-tert-Butyl-1,3-diisopropylisourea is also used as a reagent in the total synthesis of Citrafungin A which is an antifungal natural product.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB034377 |
| Pricing | Inquire |
| Cas | 71432-55-8 |
| Molecular Weight | 200.32 |
| Molecular Formula | C11H24N2O |
| Canonical SMILES | CC(C)NC(=NC(C)C)OC(C)(C)C |