Prosaptide TX14(A)
Prosaptide TX14(A) is a potent agonist of G protein-coupled receptors GPR37 and GPR37L1 (EC50 values are 7 and 5 nM, respectively). Prosaptide Tx 14(A) is the active fragment of prosaposin, a secreted neuroprotective and glioprotective factor.
| Supplier | BOC Sciences |
|---|---|
| Product # | 196391-82-9 |
| Pricing | Inquire |
| Cas | 196391-82-9 |
| Molecular Weight | 1579.72 |
| Molecular Formula | C69H110N16O26 |
| Canonical SMILES | CCC(C)C(C(=O)NC(CC(C)C)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(C(C)O)NC(=O)C(C)NC(=O)C(CC(=O)N)NC(=O)C(CC(=O)N)NC(=O)C(CC(=O)O)NC(=O)C(C(C)CC)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(C(C)O)N |