Mca-P-Cha-G-Nva-HA-Dap(DNP)-NH2
Mca-P-Cha-G-Nva-HA-Dap(DNP)-NH2 is a fluorogenic substrate for matrix metalloproteinase-1 (MMP-1), MMP-3, and MMP-26. 7-methoxycoumarin-4-acetyl (Mca) is released by cleavage of Mca-P-Cha-G-Nva-HA-Dap(DNP)-NH2, of which the fluorescence can be used to quantify MMP-1, MMP-3 and MMP-26 activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 256394-94-2 |
| Pricing | Inquire |
| Cas | 256394-94-2 |
| Molecular Weight | 1100.1 |
| Molecular Formula | C51H65N13O15 |
| Canonical SMILES | CCCC(C(=O)NC(CC1=CN=CN1)C(=O)NC(C)C(=O)NC(CNC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-])C(=O)N)NC(=O)CNC(=O)C(CC3CCCCC3)NC(=O)C4CCCN4C(=O)CC5=CC(=O)OC6=C5C=CC(=C6)OC |