Dorrigocin B
It is produced by the strain of Streptomyces platensis subsp. rosaceus AB-1981F-75. It has weak anti-tumor cell activity and moderate anti-aspergillus and fusarium activity, but has no effect on yeast. Dorrigocin B has stronger antitumor and antifungal activities than Dorrigocin A. It can restore the morphology of RAS-deformed NIH/3T3 cells from the deformed phenotype to the normal phenotype.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01171 |
| Pricing | Inquire |
| Cas | 158446-30-1 |
| Molecular Weight | 507.61 |
| Molecular Formula | C27H41NO8 |
| Canonical SMILES | CC(C=C(C)C(C(C)C(C(C=CCCC=CC(=O)O)OC)O)O)C(=O)CCCC1CC(=O)NC(=O)C1 |