6-O-tert-Butyldimethylsilyl-3,4-O-carbonyl-D-galactal
6-O-tert-Butyldimethylsilyl-3,4-O-carbonyl-D-galactal, a chemical compound applied in biomedicine for glycoconjugates synthesis, exhibits remarkable immunogenicity. Its exclusive molecular configuration contributes immensely to the research directed to vaccines development and diagnostic tools creation. Furthermore, it is imperative in objective identification of illnesses such as cancer. The compound's multifaceted applications have rendered it an invaluable asset for researchers in the biomedicine field.
| Supplier | BOC Sciences |
|---|---|
| Product # | 163228-38-4 |
| Pricing | Inquire |
| Cas | 163228-38-4 |
| Molecular Weight | 286.40 |
| Molecular Formula | C13H22O5Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OCC1C2C(C=CO1)OC(=O)O2 |