6-O-(triphenylmethyl)-D-glucopyranose
6-O-(triphenylmethyl)-D-glucopyranose, a chemical compound renowned in the pharmaceutical industry for its role in developing treatments for diabetes and other metabolic disorders, has also been studied for its potential as a gene delivery system for the treatment of genetic ailments. Its versatility continues to inspire new avenues of research and development within the scientific community.
| Supplier | BOC Sciences |
|---|---|
| Product # | 54325-28-9 |
| Pricing | Inquire |
| Cas | 54325-28-9 |
| Molecular Weight | 422.47 |
| Molecular Formula | C25H26O6 |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCC4C(C(C(C(O4)O)O)O)O |