1,2-Di-O-acetyl-3-azido-3-deoxy-5-O-benzoyl-D-ribofuranose
1,2-Di-O-acetyl-3-azido-3-deoxy-5-O-benzoyl-D-ribofuranose, a chemical compound with a multifaceted profile, is a versatile antiviral agent. With antiviral effects proven for suspected viral infections such as HIV, HSV, and HCV, the compound's unique configuration presents an opportunity to explore its potential in drug discovery and pharmaceutical development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 215176-56-0 |
| Pricing | Inquire |
| Cas | 215176-56-0 |
| Molecular Weight | 363.32 |
| Molecular Formula | C16H17N3O7 |
| Canonical SMILES | CC(=O)OC1C(C(OC1OC(=O)C)COC(=O)C2=CC=CC=C2)N=[N+]=[N-] |