Fmoc-D-tyrosine
N-Fmoc-D-tyrosine is an N-Fmoc-protected form of D-Tyrosine. D-Tyrosine is an unnatural isomer of L-Tyrosine that inhibits metabolic activity of Bacillus subtilis. It is known to exhibit antimetabolic effects on rats as well, inhibiting growth and development. D-Tyrosine is also a chiral precursor to biosynthesized inhibitors that have antiinflammatory effects in humans.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003724 |
| Pricing | Inquire |
| Cas | 112883-29-1 |
| Molecular Weight | 403.60 |
| Molecular Formula | C24H21NO5 |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=C(C=C4)O)C(=O)O |