iMDK
iMDK is an inhibitor of midkine (MDK) expression, a growth factor commonly expressed in malignant tumors. iMDK dose-dependently inhibits MDK expression to attenuate certain tumor cell growth. It inhibits PI3K/Akt pathway thus induces apoptosis in MDK-expressing H441 lung adenocarcinoma cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 881970-80-5 |
| Pricing | Inquire |
| Cas | 881970-80-5 |
| Molecular Weight | 376.4 |
| Molecular Formula | C21H13FN2O2S |
| Canonical SMILES | C1=CC=C2C(=C1)C=C(C(=O)O2)C3=CN4C=C(SC4=N3)CC5=CC=C(C=C5)F |