USP30 inhibitor 11
USP30 inhibitor 11, a selective and potent inhibitor of ubiquitin specific peptidase 30 (USP30) (IC50 = 0.01 μM), is used for the study of cancer and conditions involving mitochondrial dysfunction. (Extracted from patent WO2017009650A1, the example 83)
| Supplier | BOC Sciences |
|---|---|
| Product # | 2067332-64-1 |
| Pricing | Inquire |
| Cas | 2067332-64-1 |
| Molecular Weight | 368.41 |
| Molecular Formula | C17H16N6O2S |
| Canonical SMILES | CN(C1=NC(=CS1)C2=NC(=C(C=C2)OC)C#N)C(=O)C3CCCN3C#N |