(2S,4S)-1[2-hydroxymethyl-1,3-dioxolan-4-yl]uracil
(2S,4S)-1[2-hydroxymethyl-1,3-dioxolan-4-yl]uracil, dubbed as a paradigm-shifting compound, plays a pivotal role in the ever-evolving landscape of the biomedical industry. Harnessing its exceptional chemical architecture, this invaluable entity propels the realm of antiviral drug development, specifically targeting afflictions provoked by notorious viral assailants such as herpes and HIV. Owing to its formidable antiviral efficacy, this compound materializes as a beacon of hope, instigating further scientific scrutiny and heralding potential therapeutic breakthroughs within the realm of esteemed biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 207920-78-3 |
| Pricing | Inquire |
| Cas | 207920-78-3 |
| Molecular Weight | 214.18 |
| Molecular Formula | C8H10N2O5 |
| Canonical SMILES | C1C(OC(O1)CO)N2C=CC(=O)NC2=O |