1,2,3,4-Tetra-O-acetyl-6-deoxy-6-fluoro-D-galactopyranose
1,2,3,4-Tetra-O-acetyl-6-deoxy-6-fluoro-D-galactopyranose, a compound of utmost importance in the field of biomedicine, has garnered significant attention due to its immense potential in the realm of antiviral drug discovery. Remarkably, it displays formidable inhibitory prowess against a range of viral infections, with a particular emphasis on the notorious influenza virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 155488-15-6 |
| Pricing | Inquire |
| Cas | 155488-15-6 |
| Molecular Weight | 350.29 |
| Molecular Formula | C14H19FO9 |
| Canonical SMILES | CC(=O)OC1C(OC(C(C1OC(=O)C)OC(=O)C)OC(=O)C)CF |