BIM 23056 acetate
BIM 23056 acetate is a potent and surmountable human recombinant somatostatin receptor antagonist (Ki = 142, >1000, 10.8, 16.6 and 5.7 nM for human cloned sst1-5 receptors, respectively). It acts as an antagonist on SRIF14-induced [35S]-GTPĪ³S binding at sst3 and sst5 receptors (PKB = 6.33 and 5.84, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016403 |
| Pricing | Inquire |
| Cas | 2763584-06-9 |
| Molecular Weight | 1292.52 |
| Molecular Formula | C73H85N11O11 |
| Canonical SMILES | CC(C)C(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC2=CC3=CC=CC=C3C=C2)C(=O)N)NC(=O)C(CCCCN)NC(=O)C(CC4=CNC5=CC=CC=C54)NC(=O)C(CC6=CC=C(C=C6)O)NC(=O)C(CC7=CC=CC=C7)NC(=O)C(CC8=CC=CC=C8)N.CC(=O)O |