Dehydro Felodipine-[d3]
Dehydro Felodipine-[d3], is the labelled analogue of Dehydro Felodipine, which is a metabolite of Felodipine. Felodipine is a medication of the calcium channel blocker type which is used to treat high blood pressure.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002468 |
| Pricing | Inquire |
| Cas | 1189916-52-6 |
| Molecular Weight | 385.26 |
| Molecular Formula | C18H14D3Cl2NO4 |
| Canonical SMILES | CCOC(=O)C1=C(C(=C(N=C1C)C)C(=O)OC)C2=C(C(=CC=C2)Cl)Cl |