Hexapeptide-9
Hexapeptide-9 is a novel small molecule synthetic six-membered polypeptide consisting of two Gly-Pro-Glin sequences with the same sequence as human collagen IV and XVII. Hexapeptide-9 is an anti-aging that triggers the skin into regeneration of its damaged cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-006225 |
| Pricing | Inquire |
| Cas | 885024-94-2 |
| Molecular Weight | 582.61 |
| Molecular Formula | C24H38N8O9 |
| Canonical SMILES | O=C(N)CCC(NC(=O)C1N(C(=O)CNC(=O)C(NC(=O)C2N(C(=O)CN)CCC2)CCC(=O)N)CCC1)C(=O)O |