Lucidenic acid E
Lucidenic acid E, a triterpenoid derived from Ganoderma lucidum, exhibits potent anti-inflammatory, anti-tumor and anti-diabetic activities. Notably, it has demonstrated the ability to impede in vitro cancer cell growth, indicating its potential therapeutic value. Its hepatoprotective and antioxidant effects further increase the promise of lucidenic acid E in the treatment of liver ailments. Such multifaceted properties of this natural compound highlight its potential in the development of novel therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0005-465651 |
| Pricing | Inquire |
| Cas | 98665-17-9 |
| Molecular Weight | 516.631 |
| Molecular Formula | C29H40O8 |
| Canonical SMILES | CC(CCC(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(=O)CC4C3(CCC(C4(C)C)O)C)OC(=O)C)C)C |