Cl-HIBO
Cl-HIBO is a strongly desensitising and subtype-selective AMPA receptor agonist, which is a heterotetrameric transmembrane receptor and is found in various areas of the brain. It is selective for GluR1 and GluR2 subunit-containing receptors with EC50 values of 4.7 and 1.7 μM for rat recombinant homomeric GluR1 and 2 receptors respectively. It mediates fast synaptic transmission in the central nervous system.
| Supplier | BOC Sciences |
|---|---|
| Product # | 909400-43-7 |
| Pricing | Inquire |
| Cas | 909400-43-7 |
| Molecular Weight | 206.59 |
| Molecular Formula | C6H7ClN2O4 |
| Canonical SMILES | C(C1=C(C(=O)NO1)Cl)C(C(=O)O)N |