4-Methylumbelliferyl b-L-fucopyranoside
4-Methylumbelliferyl b-L-fucopyranoside is a biomedicine product widely used in the biomedical industry for the detection and analysis of specific enzymes involved in various diseases. Its fluorescent properties make it suitable for detecting and quantifying the presence of the enzyme β-L-fucosidase, which is associated with lysosomal storage disorders and other metabolic diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72601-82-2 |
| Pricing | Inquire |
| Cas | 72601-82-2 |
| Molecular Weight | 322.31 |
| Molecular Formula | C16H18O7 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O |