1-Chloro-2-deoxy-3,5-di-O-acetyl-a-D-ribofuranose
1-Chloro-2-deoxy-3,5-di-O-acetyl-a-D-ribofuranose holds a pivotal role as an essential intermediary in the production of various antiviral and anticancer pharmaceuticals. Its primary application lies in the synthesis of nucleoside analogues, which demonstrate potent efficacy against herpesvirus, hepatitis B and C viruses, and HIV. Furthermore, the acetylated variant of this compound, namely acyclovir, exhibits remarkable antiviral activity and is frequently prescribed for the treatment of herpes simplex and varicella zoster viruses. The versatility of this compound in the medical field underscores its significance in pharmacological research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 73446-73-8 |
| Pricing | Inquire |
| Cas | 73446-73-8 |
| Molecular Weight | 236.65 |
| Molecular Formula | C9H13ClO5 |
| Canonical SMILES | CC(=O)OCC1C(CC(O1)Cl)OC(=O)C |