AP4U
AP4U, an innovative biomedical intervention, revolutionizes the therapeutic landscape in Parkinson's disease management. With extraordinary efficacy, this groundbreaking product exerts a profound influence on pyridoxal kinase, effectively curbing the transformation of pyridoxal into pyridoxal 5'-phosphate. Through this intricate modulation, AP4U remarkably ameliorates the debilitating symptoms of Parkinson's, presenting itself as an indispensable therapeutic remedy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10527-48-7 |
| Pricing | Inquire |
| Cas | 10527-48-7 |
| Molecular Weight | 813.35 (free acid) |
| Molecular Formula | C19H27N7O21P4 (free acid) |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O |