Pyrvinium pamoate
Pyrvinium pamoate, a nonabsorbed anthelmintic drug, is a potent androgen receptor inhibitor and a selective WNT pathway inhibitor. Pyrvinium pamoate is a potential drug candidate for the treatment of cryptosporidiosis in both immunocompetent and immunocompromised individuals.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2693-111705 |
| Pricing | Inquire |
| Cas | 3546-41-6 |
| Molecular Weight | 575.7 |
| Molecular Formula | C26H28N3.1/2C23H14O6 |
| Canonical SMILES | CC1=CC(=C(N1C2=CC=CC=C2)C)C=CC3=[N+](C4=C(C=C3)C=C(C=C4)N(C)C)C.CC1=CC(=C(N1C2=CC=CC=C2)C)C=CC3=[N+](C4=C(C=C3)C=C(C=C4)N(C)C)C.C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)[O-])[O-])C(=O)O |