2-Methoxypyridine-5-boronic acid pinacol ester

2-Methoxypyridine-5-boronic acid pinacol ester is a biomedical product used in the development of drugs targeting various diseases. This compound acts as a boronic acid ester, enabling it to specifically interact with biological targets involved in disease processes. By incorporating this compound, researchers can enhance the medicinal properties and optimize the therapeutic efficacy of drugs against specific diseases.
Supplier BOC Sciences
Product # 445264-61-9
Pricing Inquire
Cas 445264-61-9
Molecular Weight 235.09
Molecular Formula C12H18BNO3
Canonical SMILES B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)OC
Feedback