ZD 7288
ZD 7288 is a reported blocker of the hyperpolarization activated cation current If (HCN channel). ZD 7288 modulates the sino-atrial node function, and slows heart rate. ZD 7288 blocks Ih in central neurons.
| Supplier | BOC Sciences |
|---|---|
| Product # | 133059-99-1 |
| Pricing | Inquire |
| Cas | 133059-99-1 |
| Molecular Weight | 292.81 |
| Molecular Formula | C15H21ClN4 |
| Canonical SMILES | CCN(C1=CC=CC=C1)C2=CC(=NC)N(C(=N2)C)C.Cl |