Arotinolol hydrochloride
Arotinolol hydrochloride is a medication used primarily for the treatment of hypertension and certain types of arrhythmias. Arotinolol is a non-selective beta-adrenergic receptor antagonist (beta-blocker) that blocks both beta-1 and beta-2 receptors. This action reduces the effects of adrenaline and noradrenaline, leading to a decrease in heart rate and blood pressure. In addition to its beta-blocking properties, arotinolol also exhibits alpha-1 adrenergic receptor antagonism. This action leads to vasodilation and further reduction in blood pressure. Arotinolol is used to treat high blood pressure, helping to prevent complications such as stroke, heart attack, and kidney problems. It can be used to manage certain types of cardiac arrhythmias (irregular heartbeats). Arotinolol may be used to alleviate symptoms of angina, a condition characterized by chest pain due to reduced blood flow to the heart.
| Supplier | BOC Sciences |
|---|---|
| Product # | 68377-91-3 |
| Pricing | Inquire |
| Cas | 68377-91-3 |
| Molecular Weight | 408.01 |
| Molecular Formula | C15H22ClN3O2S3 |
| Canonical SMILES | CC(C)(C)NCC(CSC1=NC(=CS1)C2=CC=C(S2)C(=O)N)O.Cl |