L-Triguluronic acid
L-Triguluronic acid, a linear polysaccharide copolymer composed of three L-guluronic acid (G), can be used for the synthesis of Alginate. Alginate is a generic name of unbranched polyanionic polysaccharides and can be used for the study of antifungal agents delivery carries.
| Supplier | BOC Sciences |
|---|---|
| Product # | 66754-14-1 |
| Pricing | Inquire |
| Cas | 66754-14-1 |
| Molecular Weight | 546.39 |
| Molecular Formula | C18H26O19 |
| Canonical SMILES | C1(C(C(OC(C1O)OC2C(C(C(OC2C(=O)O)OC3C(C(C(OC3C(=O)O)O)O)O)O)O)C(=O)O)O)O |