Stilbene 420
Stilbene 420 is a renowned chemical compound prominently employed in the biomedicine realm. It exhibits multifaceted applications in the study of assorted medical ailments encompassing cancer, diabetes, and cardiovascular maladies. Its exceptional adaptability as a potent constituent within pharmaceutical formulations instills promising prospects.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38775-22-3 |
| Pricing | Inquire |
| Cas | 38775-22-3 |
| Molecular Weight | 518.60 |
| Molecular Formula | C28H22O6S2 |
| Canonical SMILES | C1=CC=C(C(=C1)C=CC2=CC=C(C=C2)C3=CC=C(C=C3)C=CC4=CC=CC=C4S(=O)(=O)O)S(=O)(=O)O |