Decanoyl-Arg-Val-Lys-Arg-chloromethylketone
| Supplier | Creative Peptides |
|---|---|
| Product # | R0888 |
| CAS # | 150113-99-8 |
| Pricing | Inquire |
| LabelingTarget | Proprotein convertase |
| Synonyms | Decanoyl-RVKR-CMK; Decanoyl-Arg-Val-Lys-Arg-CMK; Furin Convertase Inhibitor (Chloromethylketone) |
| MolecularFormula | C34H66ClN11O5 |
| MolecularWeight | 744.42 |
| Source | Synthetic |
| Sequence | Decanoyl-Arg-Val-Lys-Arg-CMK |
| Storage | -20°C |
| Explanation | Decanoyl-RVKR-CMK is highly specific, potent, irreversible, and cell-permeable competitive subtilisin/kex2p-like proprotein convertase inhibitor. It can inhibit activity of all seven convertases (pc1, pc2, pc4, pace4, pc5, pc7 and furin). It is used as a useful antiviral agent. |
| Activity | Inhibitor |
| InChI | InChI=1S/C34H66ClN11O5/c1-4-5-6-7-8-9-10-18-28(48)43-25(17-14-21-42-34(39)40)31(50)46-29(23(2)3)32(51)45-26(15-11-12-19-36)30(49)44-24(27(47)22-35)16-13-20-41-33(37)38/h23-26,29H,4-22,36H2,1-3H3,(H,43,48)(H,44,49)(H,45,51)(H,46,50)(H4,37,38,41)(H4,39,40,42)/t24-,25-,26-,29-/m0/s1 |
| InChIKey | NHBJTTGFHCHQHS-VZTVMPNDSA-N |
| IsomericSMILES | CCCCCCCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCN=C(N)N)C(=O)CCl |
| Appearance | Crystalline solid |
| Purity | >98% |
| LongTermStorageConditions | -20 °C |