Amino-Modifier Serinol Phosphoramidite
Amino-Modifier Serinol Phosphoramidite, a chemical reagent synonymous with biomedical synthesis, plays a key role in the modification of oligonucleotides - mercifully, chock-full of amino functionalities. As a potent building block, this product holds potential for therapeutic and diagnostic development, with applications pertaining to the likes of cancer, viral infections, and genetic disorders. Well-renowned for its high purity and stability, it remains a stand-out performer in the realm of gene therapy and all matters nucleic acid drug delivery.
| Supplier | BOC Sciences |
|---|---|
| Product # | 196297-83-3 |
| Pricing | Inquire |
| Cas | 196297-83-3 |
| Molecular Weight | 887.01 |
| Molecular Formula | C51H59N4O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC(COC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)NC(=O)CCNC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |