Tibesaikosaponin V
Tibesaikosaponin V is a natural compound commonly found in traditional Chinese medicine. This product has demonstrated potential in the biomedical industry for its therapeutic properties. It has been researched for its ability to treat various diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2319668-87-4 |
| Pricing | Inquire |
| Cas | 2319668-87-4 |
| Molecular Weight | 812.98 |
| Molecular Formula | C42H68O15 |
| Canonical SMILES | O=C1C(O)C2(C(=CC(O)C3C4(C)CCC(OC5OC(C)C(O)C(OC6OC(CO)C(O)C(O)C6O)C5O)C(C)(CO)C4CCC32C)C7CC(C)(C)CCC17CO)C |