Dibenzo[b, f] [1, 4] thiazepin- 11(10H) - one 5, 5- Dioxide
Dibenzo[b, f] [1, 4] thiazepin- 11(10H) - one, 5, 5- dioxide is a useful intermediates for the preparation of antiallergic 10- (3- dimethylaminopropoxy) dibenzo[b, f] [1, 4] oxazepin- 11- one and other related compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB068486 |
| Pricing | Inquire |
| Cas | 22871-33-6 |
| Molecular Weight | 259.28 |
| Molecular Formula | C13H9NO3S |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)NC3=CC=CC=C3S2(=O)=O |