2,2-bis-[4-(4-Maleimidephenoxy)phenyl]propane
2,2-bis-[4-(4-Maleimidephenoxy)phenyl]propane is an intricate compound that finds itself involved in biomedical applications, notably as a crosslinker. This role in forming targeted drug delivery systems enhances therapeutic strategies for combating an array of cancer forms - specifically enhancing the potency of anticancer drugs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 79922-55-7 |
| Pricing | Inquire |
| Cas | 79922-55-7 |
| Molecular Weight | 570.6 |
| Molecular Formula | C35H26N2O6 |
| Canonical SMILES | CC(C)(C1=CC=C(C=C1)OC2=CC=C(C=C2)N3C(=O)C=CC3=O)C4=CC=C(C=C4)OC5=CC=C(C=C5)N6C(=O)C=CC6=O |