Alisol B 23-acetate
Alisol B acetate is a triterpene from Rhizoma Alismatis (rhizomes of Alisma plantago-aquatica). It induces apoptosis in human prostate cancer cells. It produces protective effect against ANIT-induced hepatotoxity and cholestasis, due to FXR-mediated regul
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7036 |
| Pricing | Inquire |
| Cas | 26575-95-1 |
| Molecular Weight | 514.74 |
| Molecular Formula | C32H50O5 |
| Canonical SMILES | CC(CC(C1C(O1)(C)C)OC(=O)C)C2=C3CC(C4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)O |