2-Acetamido-2,6-dideoxy-L-galactose
2-Acetamido-2,6-dideoxy-L-galactose, a monosaccharide derivative, has been investigated thoroughly for its diverse applications in the field of bacterial inhibition. Scientific studies reveal a substantial inhibitory potential of this derivative against numerous bacterial strains such as the notorious Staphylococcus aureus, which is responsible for causing infections. Apart from its anti-bacterial properties, it adds further significance as a potential precursor in the production of glycopeptide antibiotics. With remarkable results, this derivative holds tremendous promise in the advancement of new antibiotics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 49694-69-1 |
| Pricing | Inquire |
| Cas | 49694-69-1 |
| Molecular Weight | 205.21 |
| Molecular Formula | C8H15NO5 |
| Canonical SMILES | CC(C(C(C(C=O)NC(=O)C)O)O)O |