Tetra-N-acetyl Kanamycin A
Protected Kanamycin A. Antibiotic complex produced by Streptomyces kanamyceticus Okami & Umezawa from Japanese soil. Comprised of three components, kanamycin A, the major component, and kanamycins B and C, two minor congeners. Antibacterial.
Supplier | BOC Sciences |
---|---|
Product # | 20399-23-9 |
Pricing | Inquire |
Cas | 20399-23-9 |
Molecular Weight | 652.65 |
Molecular Formula | C26H44N4O15 |
Canonical SMILES | CC(=O)NCC1C(C(C(C(O1)OC2C(CC(C(C2O)OC3C(C(C(C(O3)CO)O)NC(=O)C)O)NC(=O)C)NC(=O)C)O)O)O |