1-Benzylindole-3-carboxaldehyde
1-Benzylindole-3-carbaldehyde was patented as an oncogenic ras-specific cytotoxic Oncrasin compund for treatment of cancer and viral infections. It was also studied to show its inhibitory effect on RNA polymerase II as a potential anticancer agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 10511-51-0 |
| Pricing | Inquire |
| Cas | 10511-51-0 |
| Molecular Weight | 235.28 |
| Molecular Formula | C16H13NO |
| Canonical SMILES | C1=CC=C(C=C1)CN2C=C(C3=CC=CC=C32)C=O |