Parvodicin B1
It is produced by the strain of Actinomadura paroosalo. It's a glycopeptide antibiotic. It has inhibitory effect on Staphylococcus aureus, Staphylococcus furfur, Staphylococcus hemolyticus and enterococcus faecalis. The terminal branching activity of lipid chains is greater than straight chains (C1>C2>C3>C4, B1>B2), and the chain length is greater than short chains (C2>B). It acts by inhibiting the synthesis of bacterial cell wall.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02668 |
| Pricing | Inquire |
| Cas | 110882-82-1 |
| Molecular Weight | 1718.50 |
| Molecular Formula | C82H86N8O29Cl2 |
| Canonical SMILES | CC(C)CCCCCCCC(=O)NC1C(C(C(OC1OC2=C3C=C4C=C2OC5=C(C=C(C=C5)C(C6C(=O)NC(C7=C(C(=CC(=C7)O)OC8C(C(C(C(O8)CO)O)O)O)C9=C(C=CC(=C9)C(C(=O)N6)NC(=O)C4NC(=O)C1C2=C(C(=CC(=C2)OC2=C(C=CC(=C2)C(C(=O)NC(CC2=CC=C(O3)C=C2)C(=O)N1)NC)O)O)Cl)O)C(=O)O)O)Cl)C(=O)O)O)O |